About 2-methyl-3-phenylbutanal
2-methyl-3-phenylbutanal (PubChem CID 3024886) has the molecular formula C11H14O
and a molecular weight of 162.23 g/mol. Its IUPAC name is 2-methyl-3-phenylbutanal.
Molecular Properties
| Compound Name | 2-methyl-3-phenylbutanal |
| PubChem CID | 3024886 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | 2-methyl-3-phenylbutanal |
| SMILES | CC(C=O)C(C)c1ccccc1 |
| InChI | InChI=1S/C11H14O/c1-9(8-12)10(2)11-6-4-3-5-7-11/h3-10H,1-2H3 |
| InChIKey | SMEMYAIGCRAVQX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-3-phenylbutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3-phenylbutanal?
The IUPAC name of 2-methyl-3-phenylbutanal (CID 3024886) is 2-methyl-3-phenylbutanal.
What is the SMILES notation for 2-methyl-3-phenylbutanal?
The canonical SMILES for 2-methyl-3-phenylbutanal is CC(C=O)C(C)c1ccccc1.
What is the InChIKey of 2-methyl-3-phenylbutanal?
The InChIKey is SMEMYAIGCRAVQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O/c1-9(8-12)10(2)11-6-4-3-5-7-11/h3-10H,1-2H3.
What are the key properties of 2-methyl-3-phenylbutanal?
2-methyl-3-phenylbutanal has a molecular weight of 162.23 g/mol, XLogP of 2.63, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-phenylbutanal is sourced from PubChem (CID 3024886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).