About 3-(3,4-dichlorophenyl)-2-methylbutanal
3-(3,4-dichlorophenyl)-2-methylbutanal (PubChem CID 123198585) has the molecular formula C11H12Cl2O
and a molecular weight of 231.12 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-2-methylbutanal.
Molecular Properties
| Compound Name | 3-(3,4-dichlorophenyl)-2-methylbutanal |
| PubChem CID | 123198585 |
| Molecular Formula | C11H12Cl2O |
| Molecular Weight | 231.12 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-2-methylbutanal |
| SMILES | CC(C=O)C(C)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H12Cl2O/c1-7(6-14)8(2)9-3-4-10(12)11(13)5-9/h3-8H,1-2H3 |
| InChIKey | NYKSMESOAVSZHP-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.12 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,4-dichlorophenyl)-2-methylbutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dichlorophenyl)-2-methylbutanal?
The IUPAC name of 3-(3,4-dichlorophenyl)-2-methylbutanal (CID 123198585) is 3-(3,4-dichlorophenyl)-2-methylbutanal.
What is the SMILES notation for 3-(3,4-dichlorophenyl)-2-methylbutanal?
The canonical SMILES for 3-(3,4-dichlorophenyl)-2-methylbutanal is CC(C=O)C(C)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 3-(3,4-dichlorophenyl)-2-methylbutanal?
The InChIKey is NYKSMESOAVSZHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12Cl2O/c1-7(6-14)8(2)9-3-4-10(12)11(13)5-9/h3-8H,1-2H3.
What are the key properties of 3-(3,4-dichlorophenyl)-2-methylbutanal?
3-(3,4-dichlorophenyl)-2-methylbutanal has a molecular weight of 231.12 g/mol, XLogP of 3.93, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dichlorophenyl)-2-methylbutanal is sourced from PubChem (CID 123198585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).