C13H14Cl2O — CID 87324074
2-cyclopentyl-2-(3,4-dichlorophenyl)acetaldehyde (PubChem CID 87324074) has the molecular formula C13H14Cl2O and a molecular weight of 257.16 g/mol. Its IUPAC name is 2-cyclopentyl-2-(3,4-dichlorophenyl)acetaldehyde.
| Compound Name | 2-cyclopentyl-2-(3,4-dichlorophenyl)acetaldehyde |
|---|---|
| PubChem CID | 87324074 |
| Molecular Formula | C13H14Cl2O |
| Molecular Weight | 257.16 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 2-cyclopentyl-2-(3,4-dichlorophenyl)acetaldehyde |
| SMILES | O=CC(c1ccc(Cl)c(Cl)c1)C1CCCC1 |
| InChI | InChI=1S/C13H14Cl2O/c14-12-6-5-10(7-13(12)15)11(8-16)9-3-1-2-4-9/h5-9,11H,1-4H2 |
| InChIKey | FGAYTGWASGAKPF-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.16 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|