C14H17BrCl2 — CID 63445197
[bromo-(3,4-dichlorophenyl)methyl]cycloheptane (PubChem CID 63445197) has the molecular formula C14H17BrCl2 and a molecular weight of 336.10 g/mol. Its IUPAC name is [bromo-(3,4-dichlorophenyl)methyl]cycloheptane.
| Compound Name | [bromo-(3,4-dichlorophenyl)methyl]cycloheptane |
|---|---|
| PubChem CID | 63445197 |
| Molecular Formula | C14H17BrCl2 |
| Molecular Weight | 336.10 g/mol |
| Exact Mass | 333.99 |
| IUPAC Name | [bromo-(3,4-dichlorophenyl)methyl]cycloheptane |
| SMILES | Clc1ccc(C(Br)C2CCCCCC2)cc1Cl |
| InChI | InChI=1S/C14H17BrCl2/c15-14(10-5-3-1-2-4-6-10)11-7-8-12(16)13(17)9-11/h7-10,14H,1-6H2 |
| InChIKey | SVDPPXAMTJPJCK-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.10 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|