C15H19BrCl2 — CID 65021234
[bromo-(2,4-dichlorophenyl)methyl]cyclooctane (PubChem CID 65021234) has the molecular formula C15H19BrCl2 and a molecular weight of 350.13 g/mol. Its IUPAC name is [bromo-(2,4-dichlorophenyl)methyl]cyclooctane.
| Compound Name | [bromo-(2,4-dichlorophenyl)methyl]cyclooctane |
|---|---|
| PubChem CID | 65021234 |
| Molecular Formula | C15H19BrCl2 |
| Molecular Weight | 350.13 g/mol |
| Exact Mass | 348.00 |
| IUPAC Name | [bromo-(2,4-dichlorophenyl)methyl]cyclooctane |
| SMILES | Clc1ccc(C(Br)C2CCCCCCC2)c(Cl)c1 |
| InChI | InChI=1S/C15H19BrCl2/c16-15(11-6-4-2-1-3-5-7-11)13-9-8-12(17)10-14(13)18/h8-11,15H,1-7H2 |
| InChIKey | QIGZPDDEQOGSGH-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.13 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|