C17H25Cl2NO — CID 65185302
3-amino-1-cyclooctyl-2-(2,4-dichlorophenyl)propan-1-ol (PubChem CID 65185302) has the molecular formula C17H25Cl2NO and a molecular weight of 330.30 g/mol. Its IUPAC name is 3-amino-1-cyclooctyl-2-(2,4-dichlorophenyl)propan-1-ol.
| Compound Name | 3-amino-1-cyclooctyl-2-(2,4-dichlorophenyl)propan-1-ol |
|---|---|
| PubChem CID | 65185302 |
| Molecular Formula | C17H25Cl2NO |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 3-amino-1-cyclooctyl-2-(2,4-dichlorophenyl)propan-1-ol |
| SMILES | NCC(c1ccc(Cl)cc1Cl)C(O)C1CCCCCCC1 |
| InChI | InChI=1S/C17H25Cl2NO/c18-13-8-9-14(16(19)10-13)15(11-20)17(21)12-6-4-2-1-3-5-7-12/h8-10,12,15,17,21H,1-7,11,20H2 |
| InChIKey | CEHIGDZEVWAIGJ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |