C19H25NO — CID 69271499
(1R,2R)-3-amino-1-cyclohexyl-2-naphthalen-1-ylpropan-1-ol (PubChem CID 69271499) has the molecular formula C19H25NO and a molecular weight of 283.41 g/mol. Its IUPAC name is (1R,2R)-3-amino-1-cyclohexyl-2-naphthalen-1-ylpropan-1-ol.
| Compound Name | (1R,2R)-3-amino-1-cyclohexyl-2-naphthalen-1-ylpropan-1-ol |
|---|---|
| PubChem CID | 69271499 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | (1R,2R)-3-amino-1-cyclohexyl-2-naphthalen-1-ylpropan-1-ol |
| SMILES | NC[C@@H](c1cccc2ccccc12)[C@H](O)C1CCCCC1 |
| InChI | InChI=1S/C19H25NO/c20-13-18(19(21)15-8-2-1-3-9-15)17-12-6-10-14-7-4-5-11-16(14)17/h4-7,10-12,15,18-19,21H,1-3,8-9,13,20H2/t18-,19+/m0/s1 |
| InChIKey | CKLVDGFONUGBFR-RBUKOAKNSA-N |
| XLogP | 3.82 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |