C21H23NO — CID 171264796
(1S,2R)-2-amino-1-cyclopentyl-2-phenanthren-9-ylethanol (PubChem CID 171264796) has the molecular formula C21H23NO and a molecular weight of 305.42 g/mol. Its IUPAC name is (1S,2R)-2-amino-1-cyclopentyl-2-phenanthren-9-ylethanol.
| Compound Name | (1S,2R)-2-amino-1-cyclopentyl-2-phenanthren-9-ylethanol |
|---|---|
| PubChem CID | 171264796 |
| Molecular Formula | C21H23NO |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | (1S,2R)-2-amino-1-cyclopentyl-2-phenanthren-9-ylethanol |
| SMILES | N[C@H](c1cc2ccccc2c2ccccc12)[C@@H](O)C1CCCC1 |
| InChI | InChI=1S/C21H23NO/c22-20(21(23)14-7-1-2-8-14)19-13-15-9-3-4-10-16(15)17-11-5-6-12-18(17)19/h3-6,9-14,20-21,23H,1-2,7-8,22H2/t20-,21+/m1/s1 |
| InChIKey | YBIALHBWNYNKJV-RTWAWAEBSA-N |
| XLogP | 4.54 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|