C20H23NO — CID 171270480
(1S,2R)-1-amino-3-methyl-1-phenanthren-9-ylpentan-2-ol (PubChem CID 171270480) has the molecular formula C20H23NO and a molecular weight of 293.41 g/mol. Its IUPAC name is (1S,2R)-1-amino-3-methyl-1-phenanthren-9-ylpentan-2-ol.
| Compound Name | (1S,2R)-1-amino-3-methyl-1-phenanthren-9-ylpentan-2-ol |
|---|---|
| PubChem CID | 171270480 |
| Molecular Formula | C20H23NO |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | (1S,2R)-1-amino-3-methyl-1-phenanthren-9-ylpentan-2-ol |
| SMILES | CCC(C)[C@@H](O)[C@@H](N)c1cc2ccccc2c2ccccc12 |
| InChI | InChI=1S/C20H23NO/c1-3-13(2)20(22)19(21)18-12-14-8-4-5-9-15(14)16-10-6-7-11-17(16)18/h4-13,19-20,22H,3,21H2,1-2H3/t13?,19-,20+/m0/s1 |
| InChIKey | GLAIAEZSGQEUEM-YYUCZDELSA-N |
| XLogP | 4.40 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|