C19H24O2 — CID 116756473
2-cyclohexyl-2-methoxy-1-naphthalen-1-ylethanol (PubChem CID 116756473) has the molecular formula C19H24O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is 2-cyclohexyl-2-methoxy-1-naphthalen-1-ylethanol.
| Compound Name | 2-cyclohexyl-2-methoxy-1-naphthalen-1-ylethanol |
|---|---|
| PubChem CID | 116756473 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | 2-cyclohexyl-2-methoxy-1-naphthalen-1-ylethanol |
| SMILES | COC(C1CCCCC1)C(O)c1cccc2ccccc12 |
| InChI | InChI=1S/C19H24O2/c1-21-19(15-9-3-2-4-10-15)18(20)17-13-7-11-14-8-5-6-12-16(14)17/h5-8,11-13,15,18-20H,2-4,9-10H2,1H3 |
| InChIKey | YAAPYRRCAZHNLD-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |