C20H23Br — CID 63438273
[bromo-(4-phenylphenyl)methyl]cycloheptane (PubChem CID 63438273) has the molecular formula C20H23Br and a molecular weight of 343.31 g/mol. Its IUPAC name is [bromo-(4-phenylphenyl)methyl]cycloheptane.
| Compound Name | [bromo-(4-phenylphenyl)methyl]cycloheptane |
|---|---|
| PubChem CID | 63438273 |
| Molecular Formula | C20H23Br |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | [bromo-(4-phenylphenyl)methyl]cycloheptane |
| SMILES | BrC(c1ccc(-c2ccccc2)cc1)C1CCCCCC1 |
| InChI | InChI=1S/C20H23Br/c21-20(18-10-4-1-2-5-11-18)19-14-12-17(13-15-19)16-8-6-3-7-9-16/h3,6-9,12-15,18,20H,1-2,4-5,10-11H2 |
| InChIKey | MJTFOZJMEQMIIB-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|