About 1-[bromo-(2,2-dimethylcyclopropyl)methyl]-4-phenylbenzene
1-[bromo-(2,2-dimethylcyclopropyl)methyl]-4-phenylbenzene (PubChem CID 107002682) has the molecular formula C18H19Br
and a molecular weight of 315.25 g/mol. Its IUPAC name is 1-[bromo-(2,2-dimethylcyclopropyl)methyl]-4-phenylbenzene.
Molecular Properties
| Compound Name | 1-[bromo-(2,2-dimethylcyclopropyl)methyl]-4-phenylbenzene |
| PubChem CID | 107002682 |
| Molecular Formula | C18H19Br |
| Molecular Weight | 315.25 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 1-[bromo-(2,2-dimethylcyclopropyl)methyl]-4-phenylbenzene |
| SMILES | CC1(C)CC1C(Br)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C18H19Br/c1-18(2)12-16(18)17(19)15-10-8-14(9-11-15)13-6-4-3-5-7-13/h3-11,16-17H,12H2,1-2H3 |
| InChIKey | VJMIBXOSRIDPAE-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 315.25 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-[bromo-(2,2-dimethylcyclopropyl)methyl]-4-phenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[bromo-(2,2-dimethylcyclopropyl)methyl]-4-phenylbenzene?
The IUPAC name of 1-[bromo-(2,2-dimethylcyclopropyl)methyl]-4-phenylbenzene (CID 107002682) is 1-[bromo-(2,2-dimethylcyclopropyl)methyl]-4-phenylbenzene.
What is the SMILES notation for 1-[bromo-(2,2-dimethylcyclopropyl)methyl]-4-phenylbenzene?
The canonical SMILES for 1-[bromo-(2,2-dimethylcyclopropyl)methyl]-4-phenylbenzene is CC1(C)CC1C(Br)c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1-[bromo-(2,2-dimethylcyclopropyl)methyl]-4-phenylbenzene?
The InChIKey is VJMIBXOSRIDPAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19Br/c1-18(2)12-16(18)17(19)15-10-8-14(9-11-15)13-6-4-3-5-7-13/h3-11,16-17H,12H2,1-2H3.
What are the key properties of 1-[bromo-(2,2-dimethylcyclopropyl)methyl]-4-phenylbenzene?
1-[bromo-(2,2-dimethylcyclopropyl)methyl]-4-phenylbenzene has a molecular weight of 315.25 g/mol, XLogP of 5.84, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[bromo-(2,2-dimethylcyclopropyl)methyl]-4-phenylbenzene is sourced from PubChem (CID 107002682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).