C12H14BrCl — CID 107002676
1-[bromo-(2,2-dimethylcyclopropyl)methyl]-4-chlorobenzene (PubChem CID 107002676) has the molecular formula C12H14BrCl and a molecular weight of 273.60 g/mol. Its IUPAC name is 1-[bromo-(2,2-dimethylcyclopropyl)methyl]-4-chlorobenzene.
| Compound Name | 1-[bromo-(2,2-dimethylcyclopropyl)methyl]-4-chlorobenzene |
|---|---|
| PubChem CID | 107002676 |
| Molecular Formula | C12H14BrCl |
| Molecular Weight | 273.60 g/mol |
| Exact Mass | 272.00 |
| IUPAC Name | 1-[bromo-(2,2-dimethylcyclopropyl)methyl]-4-chlorobenzene |
| SMILES | CC1(C)CC1C(Br)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H14BrCl/c1-12(2)7-10(12)11(13)8-3-5-9(14)6-4-8/h3-6,10-11H,7H2,1-2H3 |
| InChIKey | VZZFDFMTANEDLB-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.60 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|