About CID 70496086
CID 70496086 (PubChem CID 70496086) has the molecular formula C13H9Cl2Sn
and a molecular weight of 354.83 g/mol.
Molecular Properties
| Compound Name | CID 70496086 |
| PubChem CID | 70496086 |
| Molecular Formula | C13H9Cl2Sn |
| Molecular Weight | 354.83 g/mol |
| Exact Mass | 354.91 |
| IUPAC Name | — |
| SMILES | Clc1ccc(C([Sn])c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C13H9Cl2.Sn/c14-12-5-1-10(2-6-12)9-11-3-7-13(15)8-4-11;/h1-9H; |
| InChIKey | GOVNBCAOLGRWRO-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.83 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 70496086 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 70496086?
The IUPAC name of CID 70496086 (CID 70496086) is not available.
What is the SMILES notation for CID 70496086?
The canonical SMILES for CID 70496086 is Clc1ccc(C([Sn])c2ccc(Cl)cc2)cc1.
What is the InChIKey of CID 70496086?
The InChIKey is GOVNBCAOLGRWRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9Cl2.Sn/c14-12-5-1-10(2-6-12)9-11-3-7-13(15)8-4-11;/h1-9H;.
What are the key properties of CID 70496086?
CID 70496086 has a molecular weight of 354.83 g/mol, XLogP of 4.25, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 70496086 is sourced from PubChem (CID 70496086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).