About 1-chloro-4-(dichloromethyl)benzene;chloro thiohypochlorite
1-chloro-4-(dichloromethyl)benzene;chloro thiohypochlorite (PubChem CID 88502508) has the molecular formula C7H5Cl5S
and a molecular weight of 298.45 g/mol. Its IUPAC name is 1-chloro-4-(dichloromethyl)benzene;chloro thiohypochlorite.
Molecular Properties
| Compound Name | 1-chloro-4-(dichloromethyl)benzene;chloro thiohypochlorite |
| PubChem CID | 88502508 |
| Molecular Formula | C7H5Cl5S |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 295.86 |
| IUPAC Name | 1-chloro-4-(dichloromethyl)benzene;chloro thiohypochlorite |
| SMILES | ClSCl.Clc1ccc(C(Cl)Cl)cc1 |
| InChI | InChI=1S/C7H5Cl3.Cl2S/c8-6-3-1-5(2-4-6)7(9)10;1-3-2/h1-4,7H; |
| InChIKey | IQLAMIFUEDNRAB-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-4-(dichloromethyl)benzene;chloro thiohypochlorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4-(dichloromethyl)benzene;chloro thiohypochlorite?
The IUPAC name of 1-chloro-4-(dichloromethyl)benzene;chloro thiohypochlorite (CID 88502508) is 1-chloro-4-(dichloromethyl)benzene;chloro thiohypochlorite.
What is the SMILES notation for 1-chloro-4-(dichloromethyl)benzene;chloro thiohypochlorite?
The canonical SMILES for 1-chloro-4-(dichloromethyl)benzene;chloro thiohypochlorite is ClSCl.Clc1ccc(C(Cl)Cl)cc1.
What is the InChIKey of 1-chloro-4-(dichloromethyl)benzene;chloro thiohypochlorite?
The InChIKey is IQLAMIFUEDNRAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5Cl3.Cl2S/c8-6-3-1-5(2-4-6)7(9)10;1-3-2/h1-4,7H;.
What are the key properties of 1-chloro-4-(dichloromethyl)benzene;chloro thiohypochlorite?
1-chloro-4-(dichloromethyl)benzene;chloro thiohypochlorite has a molecular weight of 298.45 g/mol, XLogP of 5.84, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4-(dichloromethyl)benzene;chloro thiohypochlorite is sourced from PubChem (CID 88502508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).