C20H28P2 — CID 174693827
1,1'-biphenyl;(1-cyclohexyl-2-phosphanylethyl)phosphane (PubChem CID 174693827) has the molecular formula C20H28P2 and a molecular weight of 330.39 g/mol. Its IUPAC name is 1,1'-biphenyl;(1-cyclohexyl-2-phosphanylethyl)phosphane.
| Compound Name | 1,1'-biphenyl;(1-cyclohexyl-2-phosphanylethyl)phosphane |
|---|---|
| PubChem CID | 174693827 |
| Molecular Formula | C20H28P2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 1,1'-biphenyl;(1-cyclohexyl-2-phosphanylethyl)phosphane |
| SMILES | PCC(P)C1CCCCC1.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C8H18P2/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;9-6-8(10)7-4-2-1-3-5-7/h1-10H;7-8H,1-6,9-10H2 |
| InChIKey | FWORLOLJKRPZIS-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|