About N-(1-cyclohexyl-2,2,2-trifluoroethyl)aniline
N-(1-cyclohexyl-2,2,2-trifluoroethyl)aniline (PubChem CID 11076093) has the molecular formula C14H18F3N
and a molecular weight of 257.30 g/mol. Its IUPAC name is N-(1-cyclohexyl-2,2,2-trifluoroethyl)aniline.
Molecular Properties
| Compound Name | N-(1-cyclohexyl-2,2,2-trifluoroethyl)aniline |
| PubChem CID | 11076093 |
| Molecular Formula | C14H18F3N |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | N-(1-cyclohexyl-2,2,2-trifluoroethyl)aniline |
| SMILES | FC(F)(F)C(Nc1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C14H18F3N/c15-14(16,17)13(11-7-3-1-4-8-11)18-12-9-5-2-6-10-12/h2,5-6,9-11,13,18H,1,3-4,7-8H2 |
| InChIKey | QSCILGHGBAGWAM-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(1-cyclohexyl-2,2,2-trifluoroethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-cyclohexyl-2,2,2-trifluoroethyl)aniline?
The IUPAC name of N-(1-cyclohexyl-2,2,2-trifluoroethyl)aniline (CID 11076093) is N-(1-cyclohexyl-2,2,2-trifluoroethyl)aniline.
What is the SMILES notation for N-(1-cyclohexyl-2,2,2-trifluoroethyl)aniline?
The canonical SMILES for N-(1-cyclohexyl-2,2,2-trifluoroethyl)aniline is FC(F)(F)C(Nc1ccccc1)C1CCCCC1.
What is the InChIKey of N-(1-cyclohexyl-2,2,2-trifluoroethyl)aniline?
The InChIKey is QSCILGHGBAGWAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18F3N/c15-14(16,17)13(11-7-3-1-4-8-11)18-12-9-5-2-6-10-12/h2,5-6,9-11,13,18H,1,3-4,7-8H2.
What are the key properties of N-(1-cyclohexyl-2,2,2-trifluoroethyl)aniline?
N-(1-cyclohexyl-2,2,2-trifluoroethyl)aniline has a molecular weight of 257.30 g/mol, XLogP of 4.61, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-cyclohexyl-2,2,2-trifluoroethyl)aniline is sourced from PubChem (CID 11076093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).