C17H27N — CID 166439055
N-[(2S,3S)-3-cyclohexylpentan-2-yl]aniline (PubChem CID 166439055) has the molecular formula C17H27N and a molecular weight of 245.41 g/mol. Its IUPAC name is N-[(2S,3S)-3-cyclohexylpentan-2-yl]aniline.
| Compound Name | N-[(2S,3S)-3-cyclohexylpentan-2-yl]aniline |
|---|---|
| PubChem CID | 166439055 |
| Molecular Formula | C17H27N |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | N-[(2S,3S)-3-cyclohexylpentan-2-yl]aniline |
| SMILES | CC[C@@H](C1CCCCC1)[C@H](C)Nc1ccccc1 |
| InChI | InChI=1S/C17H27N/c1-3-17(15-10-6-4-7-11-15)14(2)18-16-12-8-5-9-13-16/h5,8-9,12-15,17-18H,3-4,6-7,10-11H2,1-2H3/t14-,17+/m0/s1 |
| InChIKey | GWKKMIVGQXIXIY-WMLDXEAASA-N |
| XLogP | 5.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |