C22H36N2O2 — CID 101445044
2-[anilino(cyclohexyl)methyl]-N-(1-hydroxy-2-methylpropan-2-yl)-2-methylbutanamide (PubChem CID 101445044) has the molecular formula C22H36N2O2 and a molecular weight of 360.54 g/mol. Its IUPAC name is 2-[anilino(cyclohexyl)methyl]-N-(1-hydroxy-2-methylpropan-2-yl)-2-methylbutanamide.
| Compound Name | 2-[anilino(cyclohexyl)methyl]-N-(1-hydroxy-2-methylpropan-2-yl)-2-methylbutanamide |
|---|---|
| PubChem CID | 101445044 |
| Molecular Formula | C22H36N2O2 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.28 |
| IUPAC Name | 2-[anilino(cyclohexyl)methyl]-N-(1-hydroxy-2-methylpropan-2-yl)-2-methylbutanamide |
| SMILES | CCC(C)(C(=O)NC(C)(C)CO)C(Nc1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C22H36N2O2/c1-5-22(4,20(26)24-21(2,3)16-25)19(17-12-8-6-9-13-17)23-18-14-10-7-11-15-18/h7,10-11,14-15,17,19,23,25H,5-6,8-9,12-13,16H2,1-4H3,(H,24,26) |
| InChIKey | AQBWVXPXQJGXTM-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |