C19H27NO4 — CID 125156207
(2R)-2-cyclohexyl-3-[[1-(4-hydroxyphenyl)-2-methylpropan-2-yl]amino]-3-oxopropanoic acid (PubChem CID 125156207) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is (2R)-2-cyclohexyl-3-[[1-(4-hydroxyphenyl)-2-methylpropan-2-yl]amino]-3-oxopropanoic acid.
| Compound Name | (2R)-2-cyclohexyl-3-[[1-(4-hydroxyphenyl)-2-methylpropan-2-yl]amino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 125156207 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | (2R)-2-cyclohexyl-3-[[1-(4-hydroxyphenyl)-2-methylpropan-2-yl]amino]-3-oxopropanoic acid |
| SMILES | CC(C)(Cc1ccc(O)cc1)NC(=O)[C@H](C(=O)O)C1CCCCC1 |
| InChI | InChI=1S/C19H27NO4/c1-19(2,12-13-8-10-15(21)11-9-13)20-17(22)16(18(23)24)14-6-4-3-5-7-14/h8-11,14,16,21H,3-7,12H2,1-2H3,(H,20,22)(H,23,24)/t16-/m1/s1 |
| InChIKey | IERVRPYWLUCURI-MRXNPFEDSA-N |
| XLogP | 3.11 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|