C28H32N2O2 — CID 71128049
1-cyclopentyl-3-[2-(4-hydroxyphenyl)-1,1-bis(3-methylphenyl)ethyl]urea (PubChem CID 71128049) has the molecular formula C28H32N2O2 and a molecular weight of 428.58 g/mol. Its IUPAC name is 1-cyclopentyl-3-[2-(4-hydroxyphenyl)-1,1-bis(3-methylphenyl)ethyl]urea.
| Compound Name | 1-cyclopentyl-3-[2-(4-hydroxyphenyl)-1,1-bis(3-methylphenyl)ethyl]urea |
|---|---|
| PubChem CID | 71128049 |
| Molecular Formula | C28H32N2O2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | 1-cyclopentyl-3-[2-(4-hydroxyphenyl)-1,1-bis(3-methylphenyl)ethyl]urea |
| SMILES | Cc1cccc(C(Cc2ccc(O)cc2)(NC(=O)NC2CCCC2)c2cccc(C)c2)c1 |
| InChI | InChI=1S/C28H32N2O2/c1-20-7-5-9-23(17-20)28(24-10-6-8-21(2)18-24,19-22-13-15-26(31)16-14-22)30-27(32)29-25-11-3-4-12-25/h5-10,13-18,25,31H,3-4,11-12,19H2,1-2H3,(H2,29,30,32) |
| InChIKey | SLLWDZBMBFWDOL-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |