C26H29FN4O — CID 70793640
1-[1-(5-amino-2-pyridinyl)-1-(3-fluoro-5-methylphenyl)-2-phenylethyl]-3-cyclopentylurea (PubChem CID 70793640) has the molecular formula C26H29FN4O and a molecular weight of 432.54 g/mol. Its IUPAC name is 1-[1-(5-amino-2-pyridinyl)-1-(3-fluoro-5-methylphenyl)-2-phenylethyl]-3-cyclopentylurea.
| Compound Name | 1-[1-(5-amino-2-pyridinyl)-1-(3-fluoro-5-methylphenyl)-2-phenylethyl]-3-cyclopentylurea |
|---|---|
| PubChem CID | 70793640 |
| Molecular Formula | C26H29FN4O |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 1-[1-(5-amino-2-pyridinyl)-1-(3-fluoro-5-methylphenyl)-2-phenylethyl]-3-cyclopentylurea |
| SMILES | Cc1cc(F)cc(C(Cc2ccccc2)(NC(=O)NC2CCCC2)c2ccc(N)cn2)c1 |
| InChI | InChI=1S/C26H29FN4O/c1-18-13-20(15-21(27)14-18)26(16-19-7-3-2-4-8-19,24-12-11-22(28)17-29-24)31-25(32)30-23-9-5-6-10-23/h2-4,7-8,11-15,17,23H,5-6,9-10,16,28H2,1H3,(H2,30,31,32) |
| InChIKey | FSRPNNDUGPLKRV-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |