C27H27F4IN4O — CID 70793531
1-(4-aminocyclohexyl)-3-[(1S)-1-[3-fluoro-5-(trifluoromethyl)phenyl]-1-(5-iodo-2-pyridinyl)-2-phenylethyl]urea (PubChem CID 70793531) has the molecular formula C27H27F4IN4O and a molecular weight of 626.44 g/mol. Its IUPAC name is 1-(4-aminocyclohexyl)-3-[(1S)-1-[3-fluoro-5-(trifluoromethyl)phenyl]-1-(5-iodo-2-pyridinyl)-2-phenylethyl]urea.
| Compound Name | 1-(4-aminocyclohexyl)-3-[(1S)-1-[3-fluoro-5-(trifluoromethyl)phenyl]-1-(5-iodo-2-pyridinyl)-2-phenylethyl]urea |
|---|---|
| PubChem CID | 70793531 |
| Molecular Formula | C27H27F4IN4O |
| Molecular Weight | 626.44 g/mol |
| Exact Mass | 626.12 |
| IUPAC Name | 1-(4-aminocyclohexyl)-3-[(1S)-1-[3-fluoro-5-(trifluoromethyl)phenyl]-1-(5-iodo-2-pyridinyl)-2-phenylethyl]urea |
| SMILES | NC1CCC(NC(=O)N[C@@](Cc2ccccc2)(c2cc(F)cc(C(F)(F)F)c2)c2ccc(I)cn2)CC1 |
| InChI | InChI=1S/C27H27F4IN4O/c28-20-13-18(12-19(14-20)27(29,30)31)26(15-17-4-2-1-3-5-17,24-11-6-21(32)16-34-24)36-25(37)35-23-9-7-22(33)8-10-23/h1-6,11-14,16,22-23H,7-10,15,33H2,(H2,35,36,37)/t22?,23?,26-/m0/s1 |
| InChIKey | IVCGOCKCYZOXDC-JGZAQREWSA-N |
| XLogP | 5.90 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.44 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|