C27H26F4IN3O2 — CID 70793502
1-cyclopentyl-3-[(1S)-1-[3-fluoro-5-(trifluoromethyl)phenyl]-1-(5-iodo-2-pyridinyl)-2-(2-methoxyphenyl)ethyl]urea (PubChem CID 70793502) has the molecular formula C27H26F4IN3O2 and a molecular weight of 627.42 g/mol. Its IUPAC name is 1-cyclopentyl-3-[(1S)-1-[3-fluoro-5-(trifluoromethyl)phenyl]-1-(5-iodo-2-pyridinyl)-2-(2-methoxyphenyl)ethyl]urea.
| Compound Name | 1-cyclopentyl-3-[(1S)-1-[3-fluoro-5-(trifluoromethyl)phenyl]-1-(5-iodo-2-pyridinyl)-2-(2-methoxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 70793502 |
| Molecular Formula | C27H26F4IN3O2 |
| Molecular Weight | 627.42 g/mol |
| Exact Mass | 627.10 |
| IUPAC Name | 1-cyclopentyl-3-[(1S)-1-[3-fluoro-5-(trifluoromethyl)phenyl]-1-(5-iodo-2-pyridinyl)-2-(2-methoxyphenyl)ethyl]urea |
| SMILES | COc1ccccc1C[C@](NC(=O)NC1CCCC1)(c1cc(F)cc(C(F)(F)F)c1)c1ccc(I)cn1 |
| InChI | InChI=1S/C27H26F4IN3O2/c1-37-23-9-5-2-6-17(23)15-26(24-11-10-21(32)16-33-24,35-25(36)34-22-7-3-4-8-22)18-12-19(27(29,30)31)14-20(28)13-18/h2,5-6,9-14,16,22H,3-4,7-8,15H2,1H3,(H2,34,35,36)/t26-/m0/s1 |
| InChIKey | SSQKTJXIMLIHQZ-SANMLTNESA-N |
| XLogP | 6.58 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.42 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|