C33H36F4N2O3 — CID 59459040
6-[3-[1-(cyclopentylcarbamoylamino)-1-[3-fluoro-5-(trifluoromethyl)phenyl]-2-phenylethyl]phenyl]hexanoic acid (PubChem CID 59459040) has the molecular formula C33H36F4N2O3 and a molecular weight of 584.65 g/mol. Its IUPAC name is 6-[3-[1-(cyclopentylcarbamoylamino)-1-[3-fluoro-5-(trifluoromethyl)phenyl]-2-phenylethyl]phenyl]hexanoic acid.
| Compound Name | 6-[3-[1-(cyclopentylcarbamoylamino)-1-[3-fluoro-5-(trifluoromethyl)phenyl]-2-phenylethyl]phenyl]hexanoic acid |
|---|---|
| PubChem CID | 59459040 |
| Molecular Formula | C33H36F4N2O3 |
| Molecular Weight | 584.65 g/mol |
| Exact Mass | 584.27 |
| IUPAC Name | 6-[3-[1-(cyclopentylcarbamoylamino)-1-[3-fluoro-5-(trifluoromethyl)phenyl]-2-phenylethyl]phenyl]hexanoic acid |
| SMILES | O=C(O)CCCCCc1cccc(C(Cc2ccccc2)(NC(=O)NC2CCCC2)c2cc(F)cc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C33H36F4N2O3/c34-28-20-26(19-27(21-28)33(35,36)37)32(22-24-11-4-1-5-12-24,39-31(42)38-29-15-7-8-16-29)25-14-9-13-23(18-25)10-3-2-6-17-30(40)41/h1,4-5,9,11-14,18-21,29H,2-3,6-8,10,15-17,22H2,(H,40,41)(H2,38,39,42) |
| InChIKey | WUQVCARCMIUQFF-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.65 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|