C32H34F4N2O4 — CID 71195258
4-[5-[(1R)-1-(cyclopentylcarbamoylamino)-1-[3-(1,1-difluoroethyl)-5-fluorophenyl]-2-phenylethyl]-2-fluorophenoxy]butanoic acid (PubChem CID 71195258) has the molecular formula C32H34F4N2O4 and a molecular weight of 586.63 g/mol. Its IUPAC name is 4-[5-[(1R)-1-(cyclopentylcarbamoylamino)-1-[3-(1,1-difluoroethyl)-5-fluorophenyl]-2-phenylethyl]-2-fluorophenoxy]butanoic acid.
| Compound Name | 4-[5-[(1R)-1-(cyclopentylcarbamoylamino)-1-[3-(1,1-difluoroethyl)-5-fluorophenyl]-2-phenylethyl]-2-fluorophenoxy]butanoic acid |
|---|---|
| PubChem CID | 71195258 |
| Molecular Formula | C32H34F4N2O4 |
| Molecular Weight | 586.63 g/mol |
| Exact Mass | 586.25 |
| IUPAC Name | 4-[5-[(1R)-1-(cyclopentylcarbamoylamino)-1-[3-(1,1-difluoroethyl)-5-fluorophenyl]-2-phenylethyl]-2-fluorophenoxy]butanoic acid |
| SMILES | CC(F)(F)c1cc(F)cc([C@](Cc2ccccc2)(NC(=O)NC2CCCC2)c2ccc(F)c(OCCCC(=O)O)c2)c1 |
| InChI | InChI=1S/C32H34F4N2O4/c1-31(35,36)23-16-24(18-25(33)17-23)32(20-21-8-3-2-4-9-21,38-30(41)37-26-10-5-6-11-26)22-13-14-27(34)28(19-22)42-15-7-12-29(39)40/h2-4,8-9,13-14,16-19,26H,5-7,10-12,15,20H2,1H3,(H,39,40)(H2,37,38,41)/t32-/m1/s1 |
| InChIKey | NESWNGIRAHXUDX-JGCGQSQUSA-N |
| XLogP | 7.05 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.63 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|