C29H27F6N2OP — CID 162553691
1-cyclopent-3-en-1-yl-3-[(1R)-1-[3-(1,1-difluoroethyl)-5-phosphanylphenyl]-1-[4-fluoro-3-(trifluoromethyl)phenyl]-2-phenylethyl]urea (PubChem CID 162553691) has the molecular formula C29H27F6N2OP and a molecular weight of 564.51 g/mol. Its IUPAC name is 1-cyclopent-3-en-1-yl-3-[(1R)-1-[3-(1,1-difluoroethyl)-5-phosphanylphenyl]-1-[4-fluoro-3-(trifluoromethyl)phenyl]-2-phenylethyl]urea.
| Compound Name | 1-cyclopent-3-en-1-yl-3-[(1R)-1-[3-(1,1-difluoroethyl)-5-phosphanylphenyl]-1-[4-fluoro-3-(trifluoromethyl)phenyl]-2-phenylethyl]urea |
|---|---|
| PubChem CID | 162553691 |
| Molecular Formula | C29H27F6N2OP |
| Molecular Weight | 564.51 g/mol |
| Exact Mass | 564.18 |
| IUPAC Name | 1-cyclopent-3-en-1-yl-3-[(1R)-1-[3-(1,1-difluoroethyl)-5-phosphanylphenyl]-1-[4-fluoro-3-(trifluoromethyl)phenyl]-2-phenylethyl]urea |
| SMILES | CC(F)(F)c1cc(P)cc([C@](Cc2ccccc2)(NC(=O)NC2CC=CC2)c2ccc(F)c(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C29H27F6N2OP/c1-27(31,32)20-13-21(15-23(39)14-20)28(17-18-7-3-2-4-8-18,37-26(38)36-22-9-5-6-10-22)19-11-12-25(30)24(16-19)29(33,34)35/h2-8,11-16,22H,9-10,17,39H2,1H3,(H2,36,37,38)/t28-/m1/s1 |
| InChIKey | BOZYKFMKPBTDCU-MUUNZHRXSA-N |
| XLogP | 6.96 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.51 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|