C31H31F5N2O4 — CID 59459180
4-[5-[(1R)-1-(cyclopentylcarbamoylamino)-1-[3-fluoro-5-(trifluoromethyl)phenyl]-2-phenylethyl]-2-fluorophenoxy]butanoic acid (PubChem CID 59459180) has the molecular formula C31H31F5N2O4 and a molecular weight of 590.59 g/mol. Its IUPAC name is 4-[5-[(1R)-1-(cyclopentylcarbamoylamino)-1-[3-fluoro-5-(trifluoromethyl)phenyl]-2-phenylethyl]-2-fluorophenoxy]butanoic acid.
| Compound Name | 4-[5-[(1R)-1-(cyclopentylcarbamoylamino)-1-[3-fluoro-5-(trifluoromethyl)phenyl]-2-phenylethyl]-2-fluorophenoxy]butanoic acid |
|---|---|
| PubChem CID | 59459180 |
| Molecular Formula | C31H31F5N2O4 |
| Molecular Weight | 590.59 g/mol |
| Exact Mass | 590.22 |
| IUPAC Name | 4-[5-[(1R)-1-(cyclopentylcarbamoylamino)-1-[3-fluoro-5-(trifluoromethyl)phenyl]-2-phenylethyl]-2-fluorophenoxy]butanoic acid |
| SMILES | O=C(O)CCCOc1cc([C@@](Cc2ccccc2)(NC(=O)NC2CCCC2)c2cc(F)cc(C(F)(F)F)c2)ccc1F |
| InChI | InChI=1S/C31H31F5N2O4/c32-24-16-22(15-23(17-24)31(34,35)36)30(19-20-7-2-1-3-8-20,38-29(41)37-25-9-4-5-10-25)21-12-13-26(33)27(18-21)42-14-6-11-28(39)40/h1-3,7-8,12-13,15-18,25H,4-6,9-11,14,19H2,(H,39,40)(H2,37,38,41)/t30-/m1/s1 |
| InChIKey | KGEAWRUIGXOCGB-SSEXGKCCSA-N |
| XLogP | 6.96 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.59 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|