C22H27NO2 — CID 166439076
(2R,3S)-2-benzyl-3-cyclohexyl-3-hydroxy-N-phenylpropanamide (PubChem CID 166439076) has the molecular formula C22H27NO2 and a molecular weight of 337.46 g/mol. Its IUPAC name is (2R,3S)-2-benzyl-3-cyclohexyl-3-hydroxy-N-phenylpropanamide.
| Compound Name | (2R,3S)-2-benzyl-3-cyclohexyl-3-hydroxy-N-phenylpropanamide |
|---|---|
| PubChem CID | 166439076 |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | (2R,3S)-2-benzyl-3-cyclohexyl-3-hydroxy-N-phenylpropanamide |
| SMILES | O=C(Nc1ccccc1)[C@H](Cc1ccccc1)[C@@H](O)C1CCCCC1 |
| InChI | InChI=1S/C22H27NO2/c24-21(18-12-6-2-7-13-18)20(16-17-10-4-1-5-11-17)22(25)23-19-14-8-3-9-15-19/h1,3-5,8-11,14-15,18,20-21,24H,2,6-7,12-13,16H2,(H,23,25)/t20-,21+/m1/s1 |
| InChIKey | CHKUSLXJELPZBI-RTWAWAEBSA-N |
| XLogP | 4.43 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |