C18H29NO2 — CID 107864962
2-[[cyclohexyl(phenyl)methyl]amino]-2-ethylpropane-1,3-diol (PubChem CID 107864962) has the molecular formula C18H29NO2 and a molecular weight of 291.43 g/mol. Its IUPAC name is 2-[[cyclohexyl(phenyl)methyl]amino]-2-ethylpropane-1,3-diol.
| Compound Name | 2-[[cyclohexyl(phenyl)methyl]amino]-2-ethylpropane-1,3-diol |
|---|---|
| PubChem CID | 107864962 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.43 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | 2-[[cyclohexyl(phenyl)methyl]amino]-2-ethylpropane-1,3-diol |
| SMILES | CCC(CO)(CO)NC(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C18H29NO2/c1-2-18(13-20,14-21)19-17(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3,5-6,9-10,16-17,19-21H,2,4,7-8,11-14H2,1H3 |
| InChIKey | TZFKWMWUJNTVSD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.43 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |