C15H18F3NO2 — CID 135154221
phenyl N-[(1S)-1-cyclohexyl-2,2,2-trifluoroethyl]carbamate (PubChem CID 135154221) has the molecular formula C15H18F3NO2 and a molecular weight of 301.31 g/mol. Its IUPAC name is phenyl N-[(1S)-1-cyclohexyl-2,2,2-trifluoroethyl]carbamate.
| Compound Name | phenyl N-[(1S)-1-cyclohexyl-2,2,2-trifluoroethyl]carbamate |
|---|---|
| PubChem CID | 135154221 |
| Molecular Formula | C15H18F3NO2 |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | phenyl N-[(1S)-1-cyclohexyl-2,2,2-trifluoroethyl]carbamate |
| SMILES | O=C(N[C@@H](C1CCCCC1)C(F)(F)F)Oc1ccccc1 |
| InChI | InChI=1S/C15H18F3NO2/c16-15(17,18)13(11-7-3-1-4-8-11)19-14(20)21-12-9-5-2-6-10-12/h2,5-6,9-11,13H,1,3-4,7-8H2,(H,19,20)/t13-/m0/s1 |
| InChIKey | DEKYSYSDRQLAAF-ZDUSSCGKSA-N |
| XLogP | 4.29 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |