C25H26O — CID 102450158
(R)-cyclohexyl-(3,5-diphenylphenyl)methanol (PubChem CID 102450158) has the molecular formula C25H26O and a molecular weight of 342.48 g/mol. Its IUPAC name is (R)-cyclohexyl-(3,5-diphenylphenyl)methanol.
| Compound Name | (R)-cyclohexyl-(3,5-diphenylphenyl)methanol |
|---|---|
| PubChem CID | 102450158 |
| Molecular Formula | C25H26O |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | (R)-cyclohexyl-(3,5-diphenylphenyl)methanol |
| SMILES | O[C@@H](c1cc(-c2ccccc2)cc(-c2ccccc2)c1)C1CCCCC1 |
| InChI | InChI=1S/C25H26O/c26-25(21-14-8-3-9-15-21)24-17-22(19-10-4-1-5-11-19)16-23(18-24)20-12-6-2-7-13-20/h1-2,4-7,10-13,16-18,21,25-26H,3,8-9,14-15H2/t25-/m1/s1 |
| InChIKey | RLPMNPSSTOVPDI-RUZDIDTESA-N |
| XLogP | 6.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |