C12H18FN — CID 81016538
3-(2-fluorophenyl)-N,2-dimethylbutan-1-amine (PubChem CID 81016538) has the molecular formula C12H18FN and a molecular weight of 195.28 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-N,2-dimethylbutan-1-amine.
| Compound Name | 3-(2-fluorophenyl)-N,2-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 81016538 |
| Molecular Formula | C12H18FN |
| Molecular Weight | 195.28 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 3-(2-fluorophenyl)-N,2-dimethylbutan-1-amine |
| SMILES | CNCC(C)C(C)c1ccccc1F |
| InChI | InChI=1S/C12H18FN/c1-9(8-14-3)10(2)11-6-4-5-7-12(11)13/h4-7,9-10,14H,8H2,1-3H3 |
| InChIKey | QIBLPKNBGXRRND-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.28 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |