C14H11F5N2OS — CID 156742480
2-[(5-methyl-2-pyridinyl)oxy]-N-(2,3,4,5,6-pentafluorophenyl)sulfanylethanamine (PubChem CID 156742480) has the molecular formula C14H11F5N2OS and a molecular weight of 350.31 g/mol. Its IUPAC name is 2-[(5-methyl-2-pyridinyl)oxy]-N-(2,3,4,5,6-pentafluorophenyl)sulfanylethanamine.
| Compound Name | 2-[(5-methyl-2-pyridinyl)oxy]-N-(2,3,4,5,6-pentafluorophenyl)sulfanylethanamine |
|---|---|
| PubChem CID | 156742480 |
| Molecular Formula | C14H11F5N2OS |
| Molecular Weight | 350.31 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | 2-[(5-methyl-2-pyridinyl)oxy]-N-(2,3,4,5,6-pentafluorophenyl)sulfanylethanamine |
| SMILES | Cc1ccc(OCCNSc2c(F)c(F)c(F)c(F)c2F)nc1 |
| InChI | InChI=1S/C14H11F5N2OS/c1-7-2-3-8(20-6-7)22-5-4-21-23-14-12(18)10(16)9(15)11(17)13(14)19/h2-3,6,21H,4-5H2,1H3 |
| InChIKey | FDTHNVIWQSGVSK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.31 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|