C13H14F5NOS — CID 166728013
4,4-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)sulfanylamino]pentan-2-one (PubChem CID 166728013) has the molecular formula C13H14F5NOS and a molecular weight of 327.32 g/mol. Its IUPAC name is 4,4-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)sulfanylamino]pentan-2-one.
| Compound Name | 4,4-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)sulfanylamino]pentan-2-one |
|---|---|
| PubChem CID | 166728013 |
| Molecular Formula | C13H14F5NOS |
| Molecular Weight | 327.32 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 4,4-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)sulfanylamino]pentan-2-one |
| SMILES | CC(C)(C)CC(=O)CNSc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H14F5NOS/c1-13(2,3)4-6(20)5-19-21-12-10(17)8(15)7(14)9(16)11(12)18/h19H,4-5H2,1-3H3 |
| InChIKey | NMSUNDNGRKBMPW-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.32 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|