C15H20FNO2 — CID 58474928
N-(2-fluorophenyl)-N,5,5-trimethyl-3-oxohexanamide (PubChem CID 58474928) has the molecular formula C15H20FNO2 and a molecular weight of 265.33 g/mol. Its IUPAC name is N-(2-fluorophenyl)-N,5,5-trimethyl-3-oxohexanamide.
| Compound Name | N-(2-fluorophenyl)-N,5,5-trimethyl-3-oxohexanamide |
|---|---|
| PubChem CID | 58474928 |
| Molecular Formula | C15H20FNO2 |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | N-(2-fluorophenyl)-N,5,5-trimethyl-3-oxohexanamide |
| SMILES | CN(C(=O)CC(=O)CC(C)(C)C)c1ccccc1F |
| InChI | InChI=1S/C15H20FNO2/c1-15(2,3)10-11(18)9-14(19)17(4)13-8-6-5-7-12(13)16/h5-8H,9-10H2,1-4H3 |
| InChIKey | MUZDWNKXUVAOQF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|