C10H13FN2O2 — CID 115179779
2-amino-N-(2-fluorophenyl)-3-hydroxy-N-methylpropanamide (PubChem CID 115179779) has the molecular formula C10H13FN2O2 and a molecular weight of 212.22 g/mol. Its IUPAC name is 2-amino-N-(2-fluorophenyl)-3-hydroxy-N-methylpropanamide.
| Compound Name | 2-amino-N-(2-fluorophenyl)-3-hydroxy-N-methylpropanamide |
|---|---|
| PubChem CID | 115179779 |
| Molecular Formula | C10H13FN2O2 |
| Molecular Weight | 212.22 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 2-amino-N-(2-fluorophenyl)-3-hydroxy-N-methylpropanamide |
| SMILES | CN(C(=O)C(N)CO)c1ccccc1F |
| InChI | InChI=1S/C10H13FN2O2/c1-13(10(15)8(12)6-14)9-5-3-2-4-7(9)11/h2-5,8,14H,6,12H2,1H3 |
| InChIKey | YTWPVRARWWLDNH-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.22 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |