C14H22N2O2 — CID 115179748
2-amino-3-hydroxy-N-methyl-N-(2-methyl-5-propan-2-ylphenyl)propanamide (PubChem CID 115179748) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 2-amino-3-hydroxy-N-methyl-N-(2-methyl-5-propan-2-ylphenyl)propanamide.
| Compound Name | 2-amino-3-hydroxy-N-methyl-N-(2-methyl-5-propan-2-ylphenyl)propanamide |
|---|---|
| PubChem CID | 115179748 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 2-amino-3-hydroxy-N-methyl-N-(2-methyl-5-propan-2-ylphenyl)propanamide |
| SMILES | Cc1ccc(C(C)C)cc1N(C)C(=O)C(N)CO |
| InChI | InChI=1S/C14H22N2O2/c1-9(2)11-6-5-10(3)13(7-11)16(4)14(18)12(15)8-17/h5-7,9,12,17H,8,15H2,1-4H3 |
| InChIKey | GYBGPRZXDZDDHG-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |