C13H12F5NO2 — CID 64991463
N-(3,3-dimethyl-2-oxobutyl)-2,3,4,5,6-pentafluorobenzamide (PubChem CID 64991463) has the molecular formula C13H12F5NO2 and a molecular weight of 309.23 g/mol. Its IUPAC name is N-(3,3-dimethyl-2-oxobutyl)-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-(3,3-dimethyl-2-oxobutyl)-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 64991463 |
| Molecular Formula | C13H12F5NO2 |
| Molecular Weight | 309.23 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | N-(3,3-dimethyl-2-oxobutyl)-2,3,4,5,6-pentafluorobenzamide |
| SMILES | CC(C)(C)C(=O)CNC(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H12F5NO2/c1-13(2,3)5(20)4-19-12(21)6-7(14)9(16)11(18)10(17)8(6)15/h4H2,1-3H3,(H,19,21) |
| InChIKey | USROEVNXRLQLTR-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.23 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|