C10H4F5NO — CID 60697788
2,3,4,5,6-pentafluoro-N-prop-2-ynylbenzamide (PubChem CID 60697788) has the molecular formula C10H4F5NO and a molecular weight of 249.14 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-prop-2-ynylbenzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-prop-2-ynylbenzamide |
|---|---|
| PubChem CID | 60697788 |
| Molecular Formula | C10H4F5NO |
| Molecular Weight | 249.14 g/mol |
| Exact Mass | 249.02 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-prop-2-ynylbenzamide |
| SMILES | C#CCNC(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C10H4F5NO/c1-2-3-16-10(17)4-5(11)7(13)9(15)8(14)6(4)12/h1H,3H2,(H,16,17) |
| InChIKey | HITPJVUSDZRLSC-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.14 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|