C12H8F5NO — CID 114160990
2,3,4,5,6-pentafluoro-N-pent-1-yn-3-ylbenzamide (PubChem CID 114160990) has the molecular formula C12H8F5NO and a molecular weight of 277.19 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-pent-1-yn-3-ylbenzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-pent-1-yn-3-ylbenzamide |
|---|---|
| PubChem CID | 114160990 |
| Molecular Formula | C12H8F5NO |
| Molecular Weight | 277.19 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-pent-1-yn-3-ylbenzamide |
| SMILES | C#CC(CC)NC(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H8F5NO/c1-3-5(4-2)18-12(19)6-7(13)9(15)11(17)10(16)8(6)14/h1,5H,4H2,2H3,(H,18,19) |
| InChIKey | VTATUAYOUYHUMO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.19 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|