C20H28F4N2O2 — CID 99794491
2,3,5,6-tetrafluoro-1-N,4-N-bis[(3S)-2-methylpentan-3-yl]benzene-1,4-dicarboxamide (PubChem CID 99794491) has the molecular formula C20H28F4N2O2 and a molecular weight of 404.45 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-1-N,4-N-bis[(3S)-2-methylpentan-3-yl]benzene-1,4-dicarboxamide.
| Compound Name | 2,3,5,6-tetrafluoro-1-N,4-N-bis[(3S)-2-methylpentan-3-yl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 99794491 |
| Molecular Formula | C20H28F4N2O2 |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 2,3,5,6-tetrafluoro-1-N,4-N-bis[(3S)-2-methylpentan-3-yl]benzene-1,4-dicarboxamide |
| SMILES | CC[C@H](NC(=O)c1c(F)c(F)c(C(=O)N[C@@H](CC)C(C)C)c(F)c1F)C(C)C |
| InChI | InChI=1S/C20H28F4N2O2/c1-7-11(9(3)4)25-19(27)13-15(21)17(23)14(18(24)16(13)22)20(28)26-12(8-2)10(5)6/h9-12H,7-8H2,1-6H3,(H,25,27)(H,26,28)/t11-,12-/m0/s1 |
| InChIKey | TVKFJDIRXKMZFL-RYUDHWBXSA-N |
| XLogP | 4.57 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|