C13H15F4NO — CID 139319313
2,3,5,6-tetrafluoro-4-methyl-N-(2-methylbutyl)benzamide (PubChem CID 139319313) has the molecular formula C13H15F4NO and a molecular weight of 277.26 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-methyl-N-(2-methylbutyl)benzamide.
| Compound Name | 2,3,5,6-tetrafluoro-4-methyl-N-(2-methylbutyl)benzamide |
|---|---|
| PubChem CID | 139319313 |
| Molecular Formula | C13H15F4NO |
| Molecular Weight | 277.26 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-methyl-N-(2-methylbutyl)benzamide |
| SMILES | CCC(C)CNC(=O)c1c(F)c(F)c(C)c(F)c1F |
| InChI | InChI=1S/C13H15F4NO/c1-4-6(2)5-18-13(19)8-11(16)9(14)7(3)10(15)12(8)17/h6H,4-5H2,1-3H3,(H,18,19) |
| InChIKey | RDJAZUJBFYGALL-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.26 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|