C24H39N3O3 — CID 70884498
1-N,3-N,5-N-tris(2-methylbutyl)benzene-1,3,5-tricarboxamide (PubChem CID 70884498) has the molecular formula C24H39N3O3 and a molecular weight of 417.59 g/mol. Its IUPAC name is 1-N,3-N,5-N-tris(2-methylbutyl)benzene-1,3,5-tricarboxamide.
| Compound Name | 1-N,3-N,5-N-tris(2-methylbutyl)benzene-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 70884498 |
| Molecular Formula | C24H39N3O3 |
| Molecular Weight | 417.59 g/mol |
| Exact Mass | 417.30 |
| IUPAC Name | 1-N,3-N,5-N-tris(2-methylbutyl)benzene-1,3,5-tricarboxamide |
| SMILES | CCC(C)CNC(=O)c1cc(C(=O)NCC(C)CC)cc(C(=O)NCC(C)CC)c1 |
| InChI | InChI=1S/C24H39N3O3/c1-7-16(4)13-25-22(28)19-10-20(23(29)26-14-17(5)8-2)12-21(11-19)24(30)27-15-18(6)9-3/h10-12,16-18H,7-9,13-15H2,1-6H3,(H,25,28)(H,26,29)(H,27,30) |
| InChIKey | YZRQNQLWVJVOEB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.59 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |