C12H17BFNO3 — CID 164711167
[3-fluoro-5-(2-methylbutylcarbamoyl)phenyl]boronic acid (PubChem CID 164711167) has the molecular formula C12H17BFNO3 and a molecular weight of 253.08 g/mol. Its IUPAC name is [3-fluoro-5-(2-methylbutylcarbamoyl)phenyl]boronic acid.
| Compound Name | [3-fluoro-5-(2-methylbutylcarbamoyl)phenyl]boronic acid |
|---|---|
| PubChem CID | 164711167 |
| Molecular Formula | C12H17BFNO3 |
| Molecular Weight | 253.08 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | [3-fluoro-5-(2-methylbutylcarbamoyl)phenyl]boronic acid |
| SMILES | CCC(C)CNC(=O)c1cc(F)cc(B(O)O)c1 |
| InChI | InChI=1S/C12H17BFNO3/c1-3-8(2)7-15-12(16)9-4-10(13(17)18)6-11(14)5-9/h4-6,8,17-18H,3,7H2,1-2H3,(H,15,16) |
| InChIKey | KGBLMIPWLFSOIN-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.08 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|