C21H43BN2O3 — CID 164968228
ethane;2-methylbutan-1-amine;[4-(2-methylbutylcarbamoyl)phenyl]boronic acid (PubChem CID 164968228) has the molecular formula C21H43BN2O3 and a molecular weight of 382.40 g/mol. Its IUPAC name is ethane;2-methylbutan-1-amine;[4-(2-methylbutylcarbamoyl)phenyl]boronic acid.
| Compound Name | ethane;2-methylbutan-1-amine;[4-(2-methylbutylcarbamoyl)phenyl]boronic acid |
|---|---|
| PubChem CID | 164968228 |
| Molecular Formula | C21H43BN2O3 |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.34 |
| IUPAC Name | ethane;2-methylbutan-1-amine;[4-(2-methylbutylcarbamoyl)phenyl]boronic acid |
| SMILES | CC.CC.CCC(C)CN.CCC(C)CNC(=O)c1ccc(B(O)O)cc1 |
| InChI | InChI=1S/C12H18BNO3.C5H13N.2C2H6/c1-3-9(2)8-14-12(15)10-4-6-11(7-5-10)13(16)17;1-3-5(2)4-6;2*1-2/h4-7,9,16-17H,3,8H2,1-2H3,(H,14,15);5H,3-4,6H2,1-2H3;2*1-2H3 |
| InChIKey | CTMHSLWZBWAXHH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|