C16H29BNO3 — CID 167532021
CID 167532021 (PubChem CID 167532021) has the molecular formula C16H29BNO3 and a molecular weight of 294.22 g/mol.
| Compound Name | CID 167532021 |
|---|---|
| PubChem CID | 167532021 |
| Molecular Formula | C16H29BNO3 |
| Molecular Weight | 294.22 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | — |
| SMILES | CC.CC.CCC(C)CNC(=O)c1ccc(O[B]O)cc1 |
| InChI | InChI=1S/C12H17BNO3.2C2H6/c1-3-9(2)8-14-12(15)10-4-6-11(7-5-10)17-13-16;2*1-2/h4-7,9,16H,3,8H2,1-2H3,(H,14,15);2*1-2H3 |
| InChIKey | RYRNIQTVBFWSMQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.22 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|