C16H17BFNO4 — CID 134068208
[3-fluoro-5-[[4-(methoxymethyl)phenyl]methylcarbamoyl]phenyl]boronic acid (PubChem CID 134068208) has the molecular formula C16H17BFNO4 and a molecular weight of 317.13 g/mol. Its IUPAC name is [3-fluoro-5-[[4-(methoxymethyl)phenyl]methylcarbamoyl]phenyl]boronic acid.
| Compound Name | [3-fluoro-5-[[4-(methoxymethyl)phenyl]methylcarbamoyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 134068208 |
| Molecular Formula | C16H17BFNO4 |
| Molecular Weight | 317.13 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | [3-fluoro-5-[[4-(methoxymethyl)phenyl]methylcarbamoyl]phenyl]boronic acid |
| SMILES | COCc1ccc(CNC(=O)c2cc(F)cc(B(O)O)c2)cc1 |
| InChI | InChI=1S/C16H17BFNO4/c1-23-10-12-4-2-11(3-5-12)9-19-16(20)13-6-14(17(21)22)8-15(18)7-13/h2-8,21-22H,9-10H2,1H3,(H,19,20) |
| InChIKey | NSWSRPADZJZCJN-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.13 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|