C17H16F2N2O2 — CID 134039163
N-[[4-(dimethylcarbamoyl)phenyl]methyl]-3,5-difluorobenzamide (PubChem CID 134039163) has the molecular formula C17H16F2N2O2 and a molecular weight of 318.32 g/mol. Its IUPAC name is N-[[4-(dimethylcarbamoyl)phenyl]methyl]-3,5-difluorobenzamide.
| Compound Name | N-[[4-(dimethylcarbamoyl)phenyl]methyl]-3,5-difluorobenzamide |
|---|---|
| PubChem CID | 134039163 |
| Molecular Formula | C17H16F2N2O2 |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | N-[[4-(dimethylcarbamoyl)phenyl]methyl]-3,5-difluorobenzamide |
| SMILES | CN(C)C(=O)c1ccc(CNC(=O)c2cc(F)cc(F)c2)cc1 |
| InChI | InChI=1S/C17H16F2N2O2/c1-21(2)17(23)12-5-3-11(4-6-12)10-20-16(22)13-7-14(18)9-15(19)8-13/h3-9H,10H2,1-2H3,(H,20,22) |
| InChIKey | VHRMLOOJLPPOPF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |