C18H19FN4O3 — CID 87003303
4-[[[(4-fluorobenzoyl)amino]carbamoylamino]methyl]-N,N-dimethylbenzamide (PubChem CID 87003303) has the molecular formula C18H19FN4O3 and a molecular weight of 358.37 g/mol. Its IUPAC name is 4-[[[(4-fluorobenzoyl)amino]carbamoylamino]methyl]-N,N-dimethylbenzamide.
| Compound Name | 4-[[[(4-fluorobenzoyl)amino]carbamoylamino]methyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 87003303 |
| Molecular Formula | C18H19FN4O3 |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 4-[[[(4-fluorobenzoyl)amino]carbamoylamino]methyl]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(CNC(=O)NNC(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C18H19FN4O3/c1-23(2)17(25)14-5-3-12(4-6-14)11-20-18(26)22-21-16(24)13-7-9-15(19)10-8-13/h3-10H,11H2,1-2H3,(H,21,24)(H2,20,22,26) |
| InChIKey | MHQHSLYXKGIKDS-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|